C22H41NaO6S — CID 59079319
sodium 1-(2-butylhexoxy)-4-(2-ethylhexoxy)-1,4-dioxobutane-2-sulfinate (PubChem CID 59079319) has the molecular formula C22H41NaO6S and a molecular weight of 456.62 g/mol. Its IUPAC name is sodium 1-(2-butylhexoxy)-4-(2-ethylhexoxy)-1,4-dioxobutane-2-sulfinate.
| Compound Name | sodium 1-(2-butylhexoxy)-4-(2-ethylhexoxy)-1,4-dioxobutane-2-sulfinate |
|---|---|
| PubChem CID | 59079319 |
| Molecular Formula | C22H41NaO6S |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | sodium 1-(2-butylhexoxy)-4-(2-ethylhexoxy)-1,4-dioxobutane-2-sulfinate |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CCCC)CCCC)S(=O)[O-].[Na+] |
| InChI | InChI=1S/C22H42O6S.Na/c1-5-9-12-18(8-4)16-27-21(23)15-20(29(25)26)22(24)28-17-19(13-10-6-2)14-11-7-3;/h18-20H,5-17H2,1-4H3,(H,25,26);/q;+1/p-1 |
| InChIKey | AQTNGKJFVASHIO-UHFFFAOYSA-M |
| XLogP | 1.93 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|