C22H42O6S — CID 59079320
1-(2-butylhexoxy)-4-(2-ethylhexoxy)-1,4-dioxobutane-2-sulfinic acid (PubChem CID 59079320) has the molecular formula C22H42O6S and a molecular weight of 434.64 g/mol. Its IUPAC name is 1-(2-butylhexoxy)-4-(2-ethylhexoxy)-1,4-dioxobutane-2-sulfinic acid.
| Compound Name | 1-(2-butylhexoxy)-4-(2-ethylhexoxy)-1,4-dioxobutane-2-sulfinic acid |
|---|---|
| PubChem CID | 59079320 |
| Molecular Formula | C22H42O6S |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 1-(2-butylhexoxy)-4-(2-ethylhexoxy)-1,4-dioxobutane-2-sulfinic acid |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CCCC)CCCC)S(=O)O |
| InChI | InChI=1S/C22H42O6S/c1-5-9-12-18(8-4)16-27-21(23)15-20(29(25)26)22(24)28-17-19(13-10-6-2)14-11-7-3/h18-20H,5-17H2,1-4H3,(H,25,26) |
| InChIKey | OZHJJTRJTXNXEQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|