C34H65BrO16P2 — CID 91238952
butyl 2-[(1-butoxy-1-oxopropan-2-yl)oxy-methylphosphoryl]oxypropanoate;ethyl 3-bromo-2-methylpropanoate;ethyl 3-[(3-ethoxy-2-methyl-3-oxopropoxy)-methylphosphoryl]oxy-2-methylpropanoate (PubChem CID 91238952) has the molecular formula C34H65BrO16P2 and a molecular weight of 871.73 g/mol. Its IUPAC name is butyl 2-[(1-butoxy-1-oxopropan-2-yl)oxy-methylphosphoryl]oxypropanoate;ethyl 3-bromo-2-methylpropanoate;ethyl 3-[(3-ethoxy-2-methyl-3-oxopropoxy)-methylphosphoryl]oxy-2-methylpropanoate.
| Compound Name | butyl 2-[(1-butoxy-1-oxopropan-2-yl)oxy-methylphosphoryl]oxypropanoate;ethyl 3-bromo-2-methylpropanoate;ethyl 3-[(3-ethoxy-2-methyl-3-oxopropoxy)-methylphosphoryl]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 91238952 |
| Molecular Formula | C34H65BrO16P2 |
| Molecular Weight | 871.73 g/mol |
| Exact Mass | 870.29 |
| IUPAC Name | butyl 2-[(1-butoxy-1-oxopropan-2-yl)oxy-methylphosphoryl]oxypropanoate;ethyl 3-bromo-2-methylpropanoate;ethyl 3-[(3-ethoxy-2-methyl-3-oxopropoxy)-methylphosphoryl]oxy-2-methylpropanoate |
| SMILES | CCCCOC(=O)C(C)OP(C)(=O)OC(C)C(=O)OCCCC.CCOC(=O)C(C)CBr.CCOC(=O)C(C)COP(C)(=O)OCC(C)C(=O)OCC |
| InChI | InChI=1S/C15H29O7P.C13H25O7P.C6H11BrO2/c1-6-8-10-19-14(16)12(3)21-23(5,18)22-13(4)15(17)20-11-9-7-2;1-6-17-12(14)10(3)8-19-21(5,16)20-9-11(4)13(15)18-7-2;1-3-9-6(8)5(2)4-7/h12-13H,6-11H2,1-5H3;10-11H,6-9H2,1-5H3;5H,3-4H2,1-2H3 |
| InChIKey | FUIWFEKJXYFURK-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 202.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.73 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|