C15H22BrN3O2 — CID 91241009
tert-butyl 2-[[(5-bromo-3-pyridinyl)-methylamino]methyl]azetidine-1-carboxylate (PubChem CID 91241009) has the molecular formula C15H22BrN3O2 and a molecular weight of 356.26 g/mol. Its IUPAC name is tert-butyl 2-[[(5-bromo-3-pyridinyl)-methylamino]methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(5-bromo-3-pyridinyl)-methylamino]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 91241009 |
| Molecular Formula | C15H22BrN3O2 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | tert-butyl 2-[[(5-bromo-3-pyridinyl)-methylamino]methyl]azetidine-1-carboxylate |
| SMILES | CN(CC1CCN1C(=O)OC(C)(C)C)c1cncc(Br)c1 |
| InChI | InChI=1S/C15H22BrN3O2/c1-15(2,3)21-14(20)19-6-5-12(19)10-18(4)13-7-11(16)8-17-9-13/h7-9,12H,5-6,10H2,1-4H3 |
| InChIKey | CQFVIZVYIFCSPX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |