C27H27NO6 — CID 91242404
ethyl 2-[4-(9-butan-2-yloxy-4-methoxy-1,3-dioxobenzo[e]isoindol-2-yl)phenyl]acetate (PubChem CID 91242404) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is ethyl 2-[4-(9-butan-2-yloxy-4-methoxy-1,3-dioxobenzo[e]isoindol-2-yl)phenyl]acetate.
| Compound Name | ethyl 2-[4-(9-butan-2-yloxy-4-methoxy-1,3-dioxobenzo[e]isoindol-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 91242404 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | ethyl 2-[4-(9-butan-2-yloxy-4-methoxy-1,3-dioxobenzo[e]isoindol-2-yl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)c3c(OC)cc4cccc(OC(C)CC)c4c3C2=O)cc1 |
| InChI | InChI=1S/C27H27NO6/c1-5-16(3)34-20-9-7-8-18-15-21(32-4)24-25(23(18)20)27(31)28(26(24)30)19-12-10-17(11-13-19)14-22(29)33-6-2/h7-13,15-16H,5-6,14H2,1-4H3 |
| InChIKey | NGUUOSZTPBGRTI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|