C13H30OSi — CID 91242695
3,5-dimethylheptan-3-yloxy-ethyl-dimethylsilane (PubChem CID 91242695) has the molecular formula C13H30OSi and a molecular weight of 230.47 g/mol. Its IUPAC name is 3,5-dimethylheptan-3-yloxy-ethyl-dimethylsilane.
| Compound Name | 3,5-dimethylheptan-3-yloxy-ethyl-dimethylsilane |
|---|---|
| PubChem CID | 91242695 |
| Molecular Formula | C13H30OSi |
| Molecular Weight | 230.47 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | 3,5-dimethylheptan-3-yloxy-ethyl-dimethylsilane |
| SMILES | CCC(C)CC(C)(CC)O[Si](C)(C)CC |
| InChI | InChI=1S/C13H30OSi/c1-8-12(4)11-13(5,9-2)14-15(6,7)10-3/h12H,8-11H2,1-7H3 |
| InChIKey | SIPICZVJJZZJQU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|