About butyl(dimethyl)silyloxy cyclopentane
butyl(dimethyl)silyloxy cyclopentane (PubChem CID 70400612) has the molecular formula C11H23OSi
and a molecular weight of 199.39 g/mol.
Molecular Properties
| Compound Name | butyl(dimethyl)silyloxy cyclopentane |
| PubChem CID | 70400612 |
| Molecular Formula | C11H23OSi |
| Molecular Weight | 199.39 g/mol |
| Exact Mass | 199.15 |
| IUPAC Name | — |
| SMILES | CCCCC1(O[Si](C)C)CCCC1 |
| InChI | InChI=1S/C11H23OSi/c1-4-5-8-11(12-13(2)3)9-6-7-10-11/h4-10H2,1-3H3 |
| InChIKey | GYRRWLSEYPOJOD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butyl(dimethyl)silyloxy cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(dimethyl)silyloxy cyclopentane?
The IUPAC name of butyl(dimethyl)silyloxy cyclopentane (CID 70400612) is not available.
What is the SMILES notation for butyl(dimethyl)silyloxy cyclopentane?
The canonical SMILES for butyl(dimethyl)silyloxy cyclopentane is CCCCC1(O[Si](C)C)CCCC1.
What is the InChIKey of butyl(dimethyl)silyloxy cyclopentane?
The InChIKey is GYRRWLSEYPOJOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23OSi/c1-4-5-8-11(12-13(2)3)9-6-7-10-11/h4-10H2,1-3H3.
What are the key properties of butyl(dimethyl)silyloxy cyclopentane?
butyl(dimethyl)silyloxy cyclopentane has a molecular weight of 199.39 g/mol, XLogP of 3.76, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(dimethyl)silyloxy cyclopentane is sourced from PubChem (CID 70400612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).