C11H18F6OSi — CID 10542819
[1-(1,1,2,3,3,3-hexafluoropropyl)cyclopentyl]oxy-trimethylsilane (PubChem CID 10542819) has the molecular formula C11H18F6OSi and a molecular weight of 308.34 g/mol. Its IUPAC name is [1-(1,1,2,3,3,3-hexafluoropropyl)cyclopentyl]oxy-trimethylsilane.
| Compound Name | [1-(1,1,2,3,3,3-hexafluoropropyl)cyclopentyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10542819 |
| Molecular Formula | C11H18F6OSi |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [1-(1,1,2,3,3,3-hexafluoropropyl)cyclopentyl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC1(C(F)(F)C(F)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C11H18F6OSi/c1-19(2,3)18-9(6-4-5-7-9)10(13,14)8(12)11(15,16)17/h8H,4-7H2,1-3H3 |
| InChIKey | OEGLKMVYSMAKPG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|