C13H28F2OSi — CID 172550767
(3-ethyl-4,4-difluorooctan-3-yl)oxy-trimethylsilane (PubChem CID 172550767) has the molecular formula C13H28F2OSi and a molecular weight of 266.45 g/mol. Its IUPAC name is (3-ethyl-4,4-difluorooctan-3-yl)oxy-trimethylsilane.
| Compound Name | (3-ethyl-4,4-difluorooctan-3-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 172550767 |
| Molecular Formula | C13H28F2OSi |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (3-ethyl-4,4-difluorooctan-3-yl)oxy-trimethylsilane |
| SMILES | CCCCC(F)(F)C(CC)(CC)O[Si](C)(C)C |
| InChI | InChI=1S/C13H28F2OSi/c1-7-10-11-13(14,15)12(8-2,9-3)16-17(4,5)6/h7-11H2,1-6H3 |
| InChIKey | VUUJADGHBQGQQI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|