C19H9F33OSi — CID 102003082
trimethyl-[1,1,1,2,2,3,3,4,4,5,5,6,6,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-triacontafluoro-7-(trifluoromethyl)pentadecan-7-yl]oxysilane (PubChem CID 102003082) has the molecular formula C19H9F33OSi and a molecular weight of 908.30 g/mol. Its IUPAC name is trimethyl-[1,1,1,2,2,3,3,4,4,5,5,6,6,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-triacontafluoro-7-(trifluoromethyl)pentadecan-7-yl]oxysilane.
| Compound Name | trimethyl-[1,1,1,2,2,3,3,4,4,5,5,6,6,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-triacontafluoro-7-(trifluoromethyl)pentadecan-7-yl]oxysilane |
|---|---|
| PubChem CID | 102003082 |
| Molecular Formula | C19H9F33OSi |
| Molecular Weight | 908.30 g/mol |
| Exact Mass | 907.99 |
| IUPAC Name | trimethyl-[1,1,1,2,2,3,3,4,4,5,5,6,6,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-triacontafluoro-7-(trifluoromethyl)pentadecan-7-yl]oxysilane |
| SMILES | C[Si](C)(C)OC(C(F)(F)F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H9F33OSi/c1-54(2,3)53-4(17(44,45)46,6(22,23)8(26,27)10(30,31)13(36,37)15(40,41)18(47,48)49)5(20,21)7(24,25)9(28,29)11(32,33)12(34,35)14(38,39)16(42,43)19(50,51)52/h1-3H3 |
| InChIKey | ZZOSUZGZWKEZEN-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.30 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|