C32H14F51OSi — CID 22495113
CID 22495113 (PubChem CID 22495113) has the molecular formula C32H14F51OSi and a molecular weight of 1411.50 g/mol.
| Compound Name | CID 22495113 |
|---|---|
| PubChem CID | 22495113 |
| Molecular Formula | C32H14F51OSi |
| Molecular Weight | 1411.50 g/mol |
| Exact Mass | 1411.00 |
| IUPAC Name | — |
| SMILES | C(C(C(C(C(C(C(C(C(C(C(F)F)F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)F)C(C(C(C(C(C(C(C(C(C(C(F)F)F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)F)(C(C(C(C(C(C(C(C(C(C(F)F)F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)F)O[Si] |
| InChI | InChI=1S/C32H14F51OSi/c33-2(15(48,49)21(60,61)27(72,73)28(74,75)22(62,63)16(50,51)6(37)3(34)9(40)41)1-14(84-85,12(46)19(56,57)25(68,69)31(80,81)29(76,77)23(64,65)17(52,53)7(38)4(35)10(42)43)13(47)20(58,59)26(70,71)32(82,83)30(78,79)24(66,67)18(54,55)8(39)5(36)11(44)45/h2-13H,1H2 |
| InChIKey | SLFUYCZYNIQJRM-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 52 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 85 |
| Complexity | 2120 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1411.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 52 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|