C12H15F13OSi — CID 173249365
(4,5,5,6,6,7,7,8,8,9,10,11,11-tridecafluoro-2-methylundecan-2-yl)oxysilane (PubChem CID 173249365) has the molecular formula C12H15F13OSi and a molecular weight of 450.31 g/mol. Its IUPAC name is (4,5,5,6,6,7,7,8,8,9,10,11,11-tridecafluoro-2-methylundecan-2-yl)oxysilane.
| Compound Name | (4,5,5,6,6,7,7,8,8,9,10,11,11-tridecafluoro-2-methylundecan-2-yl)oxysilane |
|---|---|
| PubChem CID | 173249365 |
| Molecular Formula | C12H15F13OSi |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | (4,5,5,6,6,7,7,8,8,9,10,11,11-tridecafluoro-2-methylundecan-2-yl)oxysilane |
| SMILES | CC(C)(CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F)O[SiH3] |
| InChI | InChI=1S/C12H15F13OSi/c1-8(2,26-27)3-4(13)9(18,19)11(22,23)12(24,25)10(20,21)6(15)5(14)7(16)17/h4-7H,3H2,1-2,27H3 |
| InChIKey | KRUYLHZFKWAFJI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|