C23H26F24O3Si — CID 161089148
dimethoxy-[1,1,1,4,4,5,5,7,7,8,8,11,11,11-tetradecafluoro-6-(1,1,2,2,5,5,5-heptafluoropentyl)undecan-6-yl]oxy-(5,5,5-trifluoropentyl)silane (PubChem CID 161089148) has the molecular formula C23H26F24O3Si and a molecular weight of 834.50 g/mol. Its IUPAC name is dimethoxy-[1,1,1,4,4,5,5,7,7,8,8,11,11,11-tetradecafluoro-6-(1,1,2,2,5,5,5-heptafluoropentyl)undecan-6-yl]oxy-(5,5,5-trifluoropentyl)silane.
| Compound Name | dimethoxy-[1,1,1,4,4,5,5,7,7,8,8,11,11,11-tetradecafluoro-6-(1,1,2,2,5,5,5-heptafluoropentyl)undecan-6-yl]oxy-(5,5,5-trifluoropentyl)silane |
|---|---|
| PubChem CID | 161089148 |
| Molecular Formula | C23H26F24O3Si |
| Molecular Weight | 834.50 g/mol |
| Exact Mass | 834.13 |
| IUPAC Name | dimethoxy-[1,1,1,4,4,5,5,7,7,8,8,11,11,11-tetradecafluoro-6-(1,1,2,2,5,5,5-heptafluoropentyl)undecan-6-yl]oxy-(5,5,5-trifluoropentyl)silane |
| SMILES | CO[Si](CCCCC(F)(F)F)(OC)OC(C(F)(F)C(F)(F)CCC(F)(F)F)(C(F)(F)C(F)(F)CCC(F)(F)F)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C23H26F24O3Si/c1-48-51(49-2,12-4-3-5-16(30,31)32)50-20(21(42,43)13(24,25)6-9-17(33,34)35,22(44,45)14(26,27)7-10-18(36,37)38)23(46,47)15(28,29)8-11-19(39,40)41/h3-12H2,1-2H3 |
| InChIKey | UGXZSBPHQHNGBO-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.50 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|