C18H23F17O3Si — CID 89407147
methoxy-propan-2-yloxy-propyl-[3,4,4,5,5,6,6,7,7,8,8,9,9,9-tetradecafluoro-2-methyl-3-(trifluoromethyl)nonan-2-yl]oxysilane (PubChem CID 89407147) has the molecular formula C18H23F17O3Si and a molecular weight of 638.43 g/mol. Its IUPAC name is methoxy-propan-2-yloxy-propyl-[3,4,4,5,5,6,6,7,7,8,8,9,9,9-tetradecafluoro-2-methyl-3-(trifluoromethyl)nonan-2-yl]oxysilane.
| Compound Name | methoxy-propan-2-yloxy-propyl-[3,4,4,5,5,6,6,7,7,8,8,9,9,9-tetradecafluoro-2-methyl-3-(trifluoromethyl)nonan-2-yl]oxysilane |
|---|---|
| PubChem CID | 89407147 |
| Molecular Formula | C18H23F17O3Si |
| Molecular Weight | 638.43 g/mol |
| Exact Mass | 638.11 |
| IUPAC Name | methoxy-propan-2-yloxy-propyl-[3,4,4,5,5,6,6,7,7,8,8,9,9,9-tetradecafluoro-2-methyl-3-(trifluoromethyl)nonan-2-yl]oxysilane |
| SMILES | CCC[Si](OC)(OC(C)C)OC(C)(C)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H23F17O3Si/c1-7-8-39(36-6,37-9(2)3)38-10(4,5)11(19,17(30,31)32)12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)18(33,34)35/h9H,7-8H2,1-6H3 |
| InChIKey | ZZLJEZTYFLEZNY-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.43 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|