C19H18N2O2 — CID 91244100
6-(3-aminophenyl)-3-benzyl-6-methyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol (PubChem CID 91244100) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 6-(3-aminophenyl)-3-benzyl-6-methyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol.
| Compound Name | 6-(3-aminophenyl)-3-benzyl-6-methyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
|---|---|
| PubChem CID | 91244100 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 6-(3-aminophenyl)-3-benzyl-6-methyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
| SMILES | CC1(c2cccc(N)c2)c2c1c(O)n(Cc1ccccc1)c2O |
| InChI | InChI=1S/C19H18N2O2/c1-19(13-8-5-9-14(20)10-13)15-16(19)18(23)21(17(15)22)11-12-6-3-2-4-7-12/h2-10,22-23H,11,20H2,1H3 |
| InChIKey | NSABOPFPZHZXNB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|