C19H23F3N2O2 — CID 91312947
6-(3-aminophenyl)-3-hexyl-6-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol (PubChem CID 91312947) has the molecular formula C19H23F3N2O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 6-(3-aminophenyl)-3-hexyl-6-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol.
| Compound Name | 6-(3-aminophenyl)-3-hexyl-6-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
|---|---|
| PubChem CID | 91312947 |
| Molecular Formula | C19H23F3N2O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 6-(3-aminophenyl)-3-hexyl-6-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
| SMILES | CCCCCCn1c(O)c2c(c1O)C2(CC(F)(F)F)c1cccc(N)c1 |
| InChI | InChI=1S/C19H23F3N2O2/c1-2-3-4-5-9-24-16(25)14-15(17(24)26)18(14,11-19(20,21)22)12-7-6-8-13(23)10-12/h6-8,10,25-26H,2-5,9,11,23H2,1H3 |
| InChIKey | RHSZCEZXBPIUEV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|