C17H17F3N2O2 — CID 90837201
(1R,7S)-8-methyl-4-[3-(trifluoromethyl)phenyl]-4,8-diazatricyclo[5.2.2.02,6]undeca-2,5-diene-3,5-diol (PubChem CID 90837201) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is (1R,7S)-8-methyl-4-[3-(trifluoromethyl)phenyl]-4,8-diazatricyclo[5.2.2.02,6]undeca-2,5-diene-3,5-diol.
| Compound Name | (1R,7S)-8-methyl-4-[3-(trifluoromethyl)phenyl]-4,8-diazatricyclo[5.2.2.02,6]undeca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 90837201 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (1R,7S)-8-methyl-4-[3-(trifluoromethyl)phenyl]-4,8-diazatricyclo[5.2.2.02,6]undeca-2,5-diene-3,5-diol |
| SMILES | CN1C[C@@H]2CC[C@H]1c1c2c(O)n(-c2cccc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C17H17F3N2O2/c1-21-8-9-5-6-12(21)14-13(9)15(23)22(16(14)24)11-4-2-3-10(7-11)17(18,19)20/h2-4,7,9,12,23-24H,5-6,8H2,1H3/t9-,12-/m0/s1 |
| InChIKey | KVVPSCWFFRVYFL-CABZTGNLSA-N |
| XLogP | 3.77 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |