C27H30F3N3O2 — CID 54395278
4-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraene-3,5-diol (PubChem CID 54395278) has the molecular formula C27H30F3N3O2 and a molecular weight of 485.55 g/mol. Its IUPAC name is 4-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraene-3,5-diol.
| Compound Name | 4-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraene-3,5-diol |
|---|---|
| PubChem CID | 54395278 |
| Molecular Formula | C27H30F3N3O2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 4-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1CCCCN1CCN(c3cccc(C(F)(F)F)c3)CC1)C1C=CC2C2C=CC12 |
| InChI | InChI=1S/C27H30F3N3O2/c28-27(29,30)17-4-3-5-18(16-17)32-14-12-31(13-15-32)10-1-2-11-33-25(34)23-21-8-9-22(24(23)26(33)35)20-7-6-19(20)21/h3-9,16,19-22,34-35H,1-2,10-15H2 |
| InChIKey | VJMOREQMCVCROU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|