C32H35F2N3O2 — CID 54338771
4-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]butyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5,11-triene-3,5-diol (PubChem CID 54338771) has the molecular formula C32H35F2N3O2 and a molecular weight of 531.65 g/mol. Its IUPAC name is 4-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]butyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5,11-triene-3,5-diol.
| Compound Name | 4-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]butyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5,11-triene-3,5-diol |
|---|---|
| PubChem CID | 54338771 |
| Molecular Formula | C32H35F2N3O2 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 4-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]butyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5,11-triene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1CCCCN1CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC1)C1C=CC2C2CC12 |
| InChI | InChI=1S/C32H35F2N3O2/c33-22-7-3-20(4-8-22)30(21-5-9-23(34)10-6-21)36-17-15-35(16-18-36)13-1-2-14-37-31(38)28-24-11-12-25(27-19-26(24)27)29(28)32(37)39/h3-12,24-27,30,38-39H,1-2,13-19H2 |
| InChIKey | TXKUZXRLKJVYRL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|