C19H32O7Si — CID 91245897
2-O-methoxycarbonyl 1-O-methyl (1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethylcyclohex-4-ene-1,2-dicarboxylate (PubChem CID 91245897) has the molecular formula C19H32O7Si and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-O-methoxycarbonyl 1-O-methyl (1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethylcyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | 2-O-methoxycarbonyl 1-O-methyl (1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethylcyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91245897 |
| Molecular Formula | C19H32O7Si |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-O-methoxycarbonyl 1-O-methyl (1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethylcyclohex-4-ene-1,2-dicarboxylate |
| SMILES | COC(=O)OC(=O)[C@]1(C)[C@H](O[Si](C)(C)C(C)(C)C)C=CC[C@]1(C)C(=O)OC |
| InChI | InChI=1S/C19H32O7Si/c1-17(2,3)27(8,9)26-13-11-10-12-18(4,14(20)23-6)19(13,5)15(21)25-16(22)24-7/h10-11,13H,12H2,1-9H3/t13-,18-,19+/m1/s1 |
| InChIKey | LJAQSLKGANDZPI-ZNOIYHFQSA-N |
| XLogP | 3.83 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|