C18H16BrClN2O2 — CID 91246387
3-bromo-4-chloro-N-[[2-(3-cyanopropoxy)phenyl]methyl]benzamide (PubChem CID 91246387) has the molecular formula C18H16BrClN2O2 and a molecular weight of 407.70 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[[2-(3-cyanopropoxy)phenyl]methyl]benzamide.
| Compound Name | 3-bromo-4-chloro-N-[[2-(3-cyanopropoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 91246387 |
| Molecular Formula | C18H16BrClN2O2 |
| Molecular Weight | 407.70 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 3-bromo-4-chloro-N-[[2-(3-cyanopropoxy)phenyl]methyl]benzamide |
| SMILES | N#CCCCOc1ccccc1CNC(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C18H16BrClN2O2/c19-15-11-13(7-8-16(15)20)18(23)22-12-14-5-1-2-6-17(14)24-10-4-3-9-21/h1-2,5-8,11H,3-4,10,12H2,(H,22,23) |
| InChIKey | UXALAVVCKBETIO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.70 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|