C22H21FN2O4 — CID 91248982
propyl 4-(5-fluoro-2-methyl-4-oxochromen-8-yl)-3-isocyano-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate (PubChem CID 91248982) has the molecular formula C22H21FN2O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is propyl 4-(5-fluoro-2-methyl-4-oxochromen-8-yl)-3-isocyano-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate.
| Compound Name | propyl 4-(5-fluoro-2-methyl-4-oxochromen-8-yl)-3-isocyano-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 91248982 |
| Molecular Formula | C22H21FN2O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | propyl 4-(5-fluoro-2-methyl-4-oxochromen-8-yl)-3-isocyano-2,6-dimethyl-3,4-dihydropyridine-5-carboxylate |
| SMILES | [C-]#[N+]C1C(C)=NC(C)=C(C(=O)OCCC)C1c1ccc(F)c2c(=O)cc(C)oc12 |
| InChI | InChI=1S/C22H21FN2O4/c1-6-9-28-22(27)17-12(3)25-13(4)20(24-5)18(17)14-7-8-15(23)19-16(26)10-11(2)29-21(14)19/h7-8,10,18,20H,6,9H2,1-4H3 |
| InChIKey | BDMOJBABMITQJA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 73.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|