C20H16Cl2N2O3 — CID 91209659
ethyl 4-(2,4-dichlorophenyl)-6-(furan-3-yl)-3-isocyano-2-methyl-3,4-dihydropyridine-5-carboxylate (PubChem CID 91209659) has the molecular formula C20H16Cl2N2O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is ethyl 4-(2,4-dichlorophenyl)-6-(furan-3-yl)-3-isocyano-2-methyl-3,4-dihydropyridine-5-carboxylate.
| Compound Name | ethyl 4-(2,4-dichlorophenyl)-6-(furan-3-yl)-3-isocyano-2-methyl-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 91209659 |
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | ethyl 4-(2,4-dichlorophenyl)-6-(furan-3-yl)-3-isocyano-2-methyl-3,4-dihydropyridine-5-carboxylate |
| SMILES | [C-]#[N+]C1C(C)=NC(c2ccoc2)=C(C(=O)OCC)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl2N2O3/c1-4-27-20(25)17-16(14-6-5-13(21)9-15(14)22)18(23-3)11(2)24-19(17)12-7-8-26-10-12/h5-10,16,18H,4H2,1-2H3 |
| InChIKey | HFGYRKNSYGSYEH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 56.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|