C32H33FN5O5- — CID 91249186
(Z)-4-(dimethylamino)-2-[1-[5-fluoro-8-hydroxy-7-[(2-indazol-1-ylacetyl)amino]-1-methyl-9-oxo-3,4,4a,10-tetrahydro-2H-anthracen-2-yl]ethenyl]-3-hydroxybut-2-enamide (PubChem CID 91249186) has the molecular formula C32H33FN5O5- and a molecular weight of 586.64 g/mol. Its IUPAC name is (Z)-4-(dimethylamino)-2-[1-[5-fluoro-8-hydroxy-7-[(2-indazol-1-ylacetyl)amino]-1-methyl-9-oxo-3,4,4a,10-tetrahydro-2H-anthracen-2-yl]ethenyl]-3-hydroxybut-2-enamide.
| Compound Name | (Z)-4-(dimethylamino)-2-[1-[5-fluoro-8-hydroxy-7-[(2-indazol-1-ylacetyl)amino]-1-methyl-9-oxo-3,4,4a,10-tetrahydro-2H-anthracen-2-yl]ethenyl]-3-hydroxybut-2-enamide |
|---|---|
| PubChem CID | 91249186 |
| Molecular Formula | C32H33FN5O5- |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | (Z)-4-(dimethylamino)-2-[1-[5-fluoro-8-hydroxy-7-[(2-indazol-1-ylacetyl)amino]-1-methyl-9-oxo-3,4,4a,10-tetrahydro-2H-anthracen-2-yl]ethenyl]-3-hydroxybut-2-enamide |
| SMILES | [H]/[C-]=C(C(\C(N)=O)=C(\O)CN(C)C)/C1CCC2Cc3c(F)cc(NC(=O)Cn4ncc5ccccc54)c(O)c3C(=O)C2=C1C |
| InChI | InChI=1S/C32H33FN5O5/c1-16-20(17(2)28(32(34)43)25(39)14-37(3)4)10-9-18-11-21-22(33)12-23(30(41)29(21)31(42)27(16)18)36-26(40)15-38-24-8-6-5-7-19(24)13-35-38/h2,5-8,12-13,18,20,39,41H,9-11,14-15H2,1,3-4H3,(H2,34,43)(H,36,40)/q-1/b28-25- |
| InChIKey | NDEOMOHWMZBQIK-FVDSYPCUSA-N |
| XLogP | 3.82 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|