C12H16O — CID 91249500
(1R,2R,9R)-tricyclo[7.2.1.02,6]dodec-10-en-3-one (PubChem CID 91249500) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (1R,2R,9R)-tricyclo[7.2.1.02,6]dodec-10-en-3-one.
| Compound Name | (1R,2R,9R)-tricyclo[7.2.1.02,6]dodec-10-en-3-one |
|---|---|
| PubChem CID | 91249500 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (1R,2R,9R)-tricyclo[7.2.1.02,6]dodec-10-en-3-one |
| SMILES | O=C1CCC2CC[C@H]3C=C[C@@H](C3)[C@H]12 |
| InChI | InChI=1S/C12H16O/c13-11-6-5-9-3-1-8-2-4-10(7-8)12(9)11/h2,4,8-10,12H,1,3,5-7H2/t8-,9?,10-,12+/m0/s1 |
| InChIKey | ZQQCORKWZYTLJR-YFYGNXCZSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|