C21H26N6O2 — CID 91251213
2-butoxy-4-(methylideneamino)-8-(1,2,3,4-tetrahydroisoquinolin-7-ylmethyl)-5,7-dihydropteridin-6-one (PubChem CID 91251213) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-butoxy-4-(methylideneamino)-8-(1,2,3,4-tetrahydroisoquinolin-7-ylmethyl)-5,7-dihydropteridin-6-one.
| Compound Name | 2-butoxy-4-(methylideneamino)-8-(1,2,3,4-tetrahydroisoquinolin-7-ylmethyl)-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 91251213 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 2-butoxy-4-(methylideneamino)-8-(1,2,3,4-tetrahydroisoquinolin-7-ylmethyl)-5,7-dihydropteridin-6-one |
| SMILES | C=Nc1nc(OCCCC)nc2c1NC(=O)CN2Cc1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C21H26N6O2/c1-3-4-9-29-21-25-19(22-2)18-20(26-21)27(13-17(28)24-18)12-14-5-6-15-7-8-23-11-16(15)10-14/h5-6,10,23H,2-4,7-9,11-13H2,1H3,(H,24,28) |
| InChIKey | SRHUCBRIWNBOJZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|