C31H50O3 — CID 91252302
methyl (4R,8S,10R,14S)-3-hydroxy-4,8,10,14-tetramethyl-17-(6-methylhept-5-en-2-ylidene)-1,2,3,5,6,7,9,11,12,13,15,16-dodecahydrocyclopenta[a]phenanthrene-4-carboxylate (PubChem CID 91252302) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is methyl (4R,8S,10R,14S)-3-hydroxy-4,8,10,14-tetramethyl-17-(6-methylhept-5-en-2-ylidene)-1,2,3,5,6,7,9,11,12,13,15,16-dodecahydrocyclopenta[a]phenanthrene-4-carboxylate.
| Compound Name | methyl (4R,8S,10R,14S)-3-hydroxy-4,8,10,14-tetramethyl-17-(6-methylhept-5-en-2-ylidene)-1,2,3,5,6,7,9,11,12,13,15,16-dodecahydrocyclopenta[a]phenanthrene-4-carboxylate |
|---|---|
| PubChem CID | 91252302 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | methyl (4R,8S,10R,14S)-3-hydroxy-4,8,10,14-tetramethyl-17-(6-methylhept-5-en-2-ylidene)-1,2,3,5,6,7,9,11,12,13,15,16-dodecahydrocyclopenta[a]phenanthrene-4-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C(O)CC[C@@]2(C)C1CC[C@@]1(C)C2CCC2C(=C(C)CCC=C(C)C)CC[C@@]21C |
| InChI | InChI=1S/C31H50O3/c1-20(2)10-9-11-21(3)22-14-18-29(5)23(22)12-13-24-28(4)17-16-26(32)31(7,27(33)34-8)25(28)15-19-30(24,29)6/h10,23-26,32H,9,11-19H2,1-8H3/t23?,24?,25?,26?,28-,29+,30+,31-/m1/s1 |
| InChIKey | GPOBHCDLMTXXLW-ULKOYVLRSA-N |
| XLogP | 7.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|