C29H37NO7S — CID 91253093
[4-[4-(3-methoxyphenyl)-3-methylphenyl]piperidin-1-yl]sulfonyl (3aS,5R,6aR)-2,2,3a-trimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-5-carboxylate (PubChem CID 91253093) has the molecular formula C29H37NO7S and a molecular weight of 543.68 g/mol. Its IUPAC name is [4-[4-(3-methoxyphenyl)-3-methylphenyl]piperidin-1-yl]sulfonyl (3aS,5R,6aR)-2,2,3a-trimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-5-carboxylate.
| Compound Name | [4-[4-(3-methoxyphenyl)-3-methylphenyl]piperidin-1-yl]sulfonyl (3aS,5R,6aR)-2,2,3a-trimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-5-carboxylate |
|---|---|
| PubChem CID | 91253093 |
| Molecular Formula | C29H37NO7S |
| Molecular Weight | 543.68 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | [4-[4-(3-methoxyphenyl)-3-methylphenyl]piperidin-1-yl]sulfonyl (3aS,5R,6aR)-2,2,3a-trimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-5-carboxylate |
| SMILES | COc1cccc(-c2ccc(C3CCN(S(=O)(=O)OC(=O)[C@@H]4C[C@H]5OC(C)(C)O[C@@]5(C)C4)CC3)cc2C)c1 |
| InChI | InChI=1S/C29H37NO7S/c1-19-15-21(9-10-25(19)22-7-6-8-24(16-22)34-5)20-11-13-30(14-12-20)38(32,33)36-27(31)23-17-26-29(4,18-23)37-28(2,3)35-26/h6-10,15-16,20,23,26H,11-14,17-18H2,1-5H3/t23-,26-,29+/m1/s1 |
| InChIKey | GORPGYHQQMSVCM-FIYSCABWSA-N |
| XLogP | 4.96 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |