C9H10N2O6 — CID 91254257
2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid (PubChem CID 91254257) has the molecular formula C9H10N2O6 and a molecular weight of 242.19 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid.
| Compound Name | 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid |
|---|---|
| PubChem CID | 91254257 |
| Molecular Formula | C9H10N2O6 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid |
| SMILES | Cn1cc(CC(C(=O)O)(C(=O)O)C(=O)O)cn1 |
| InChI | InChI=1S/C9H10N2O6/c1-11-4-5(3-10-11)2-9(6(12)13,7(14)15)8(16)17/h3-4H,2H2,1H3,(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | IFWBBHVIAQNZSN-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|