2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid

C9H10N2O6 — CID 91254257

IUPAC2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid
SMILESCn1cc(CC(C(=O)O)(C(=O)O)C(=O)O)cn1
InChIInChI=1S/C9H10N2O6/c1-11-4-5(3-10-11)2-9(6(12)13,7(14)15)8(16)17/h3-4H,2H2,1H3,(H,12,13)(H,14,15)(H,16,17)
InChIKeyIFWBBHVIAQNZSN-UHFFFAOYSA-N
MW242.19 g/mol
LogP-0.80
Rot. Bonds5

About 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid

2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid (PubChem CID 91254257) has the molecular formula C9H10N2O6 and a molecular weight of 242.19 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid.

Molecular Properties

Compound Name2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid
PubChem CID91254257
Molecular FormulaC9H10N2O6
Molecular Weight242.19 g/mol
Exact Mass242.05
IUPAC Name2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid
SMILESCn1cc(CC(C(=O)O)(C(=O)O)C(=O)O)cn1
InChIInChI=1S/C9H10N2O6/c1-11-4-5(3-10-11)2-9(6(12)13,7(14)15)8(16)17/h3-4H,2H2,1H3,(H,12,13)(H,14,15)(H,16,17)
InChIKeyIFWBBHVIAQNZSN-UHFFFAOYSA-N
XLogP-0.80
TPSA129.72 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.19
LogP ≤ 5-0.80
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid?
The IUPAC name of 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid (CID 91254257) is 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid.
What is the SMILES notation for 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid?
The canonical SMILES for 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid is Cn1cc(CC(C(=O)O)(C(=O)O)C(=O)O)cn1.
What is the InChIKey of 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid?
The InChIKey is IFWBBHVIAQNZSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O6/c1-11-4-5(3-10-11)2-9(6(12)13,7(14)15)8(16)17/h3-4H,2H2,1H3,(H,12,13)(H,14,15)(H,16,17).
What are the key properties of 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid?
2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid has a molecular weight of 242.19 g/mol, XLogP of -0.80, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylpyrazol-4-yl)ethane-1,1,1-tricarboxylic acid is sourced from PubChem (CID 91254257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).