C12H17F3N2O4 — CID 91255660
methyl 3-[[(2S)-1-amino-1-oxobutan-2-yl]-(4,4,4-trifluorobut-2-enyl)amino]-3-oxopropanoate (PubChem CID 91255660) has the molecular formula C12H17F3N2O4 and a molecular weight of 310.27 g/mol. Its IUPAC name is methyl 3-[[(2S)-1-amino-1-oxobutan-2-yl]-(4,4,4-trifluorobut-2-enyl)amino]-3-oxopropanoate.
| Compound Name | methyl 3-[[(2S)-1-amino-1-oxobutan-2-yl]-(4,4,4-trifluorobut-2-enyl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 91255660 |
| Molecular Formula | C12H17F3N2O4 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | methyl 3-[[(2S)-1-amino-1-oxobutan-2-yl]-(4,4,4-trifluorobut-2-enyl)amino]-3-oxopropanoate |
| SMILES | CC[C@@H](C(N)=O)N(CC=CC(F)(F)F)C(=O)CC(=O)OC |
| InChI | InChI=1S/C12H17F3N2O4/c1-3-8(11(16)20)17(6-4-5-12(13,14)15)9(18)7-10(19)21-2/h4-5,8H,3,6-7H2,1-2H3,(H2,16,20)/t8-/m0/s1 |
| InChIKey | MZJFJQNHGNYFOG-QMMMGPOBSA-N |
| XLogP | 0.76 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|