C10H14O — CID 91257633
6-methyl-2,3,3a,4,5,6-hexahydroinden-1-one (PubChem CID 91257633) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 6-methyl-2,3,3a,4,5,6-hexahydroinden-1-one.
| Compound Name | 6-methyl-2,3,3a,4,5,6-hexahydroinden-1-one |
|---|---|
| PubChem CID | 91257633 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 6-methyl-2,3,3a,4,5,6-hexahydroinden-1-one |
| SMILES | CC1C=C2C(=O)CCC2CC1 |
| InChI | InChI=1S/C10H14O/c1-7-2-3-8-4-5-10(11)9(8)6-7/h6-8H,2-5H2,1H3 |
| InChIKey | HKBFMCFXIOMEMC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |