C13H13BrO4 — CID 91257651
methyl 6-(2-bromophenyl)-2,4-dioxohexanoate (PubChem CID 91257651) has the molecular formula C13H13BrO4 and a molecular weight of 313.15 g/mol. Its IUPAC name is methyl 6-(2-bromophenyl)-2,4-dioxohexanoate.
| Compound Name | methyl 6-(2-bromophenyl)-2,4-dioxohexanoate |
|---|---|
| PubChem CID | 91257651 |
| Molecular Formula | C13H13BrO4 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | methyl 6-(2-bromophenyl)-2,4-dioxohexanoate |
| SMILES | COC(=O)C(=O)CC(=O)CCc1ccccc1Br |
| InChI | InChI=1S/C13H13BrO4/c1-18-13(17)12(16)8-10(15)7-6-9-4-2-3-5-11(9)14/h2-5H,6-8H2,1H3 |
| InChIKey | BOQPBBOHZYFZMQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|