About [(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate
[(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate (PubChem CID 91259575) has the molecular formula C20H22O4
and a molecular weight of 326.39 g/mol. Its IUPAC name is [(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate.
Molecular Properties
| Compound Name | [(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate |
| PubChem CID | 91259575 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate |
| SMILES | CC(C)Cc1cccc(C(=O)OC(=O)[C@@H](C)c2ccccc2)c1O |
| InChI | InChI=1S/C20H22O4/c1-13(2)12-16-10-7-11-17(18(16)21)20(23)24-19(22)14(3)15-8-5-4-6-9-15/h4-11,13-14,21H,12H2,1-3H3/t14-/m0/s1 |
| InChIKey | KJSJQRKPECIHNG-AWEZNQCLSA-N |
| XLogP | 4.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate?
The IUPAC name of [(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate (CID 91259575) is [(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate.
What is the SMILES notation for [(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate?
The canonical SMILES for [(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate is CC(C)Cc1cccc(C(=O)OC(=O)[C@@H](C)c2ccccc2)c1O.
What is the InChIKey of [(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate?
The InChIKey is KJSJQRKPECIHNG-AWEZNQCLSA-N. The full InChI is InChI=1S/C20H22O4/c1-13(2)12-16-10-7-11-17(18(16)21)20(23)24-19(22)14(3)15-8-5-4-6-9-15/h4-11,13-14,21H,12H2,1-3H3/t14-/m0/s1.
What are the key properties of [(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate?
[(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate has a molecular weight of 326.39 g/mol, XLogP of 4.08, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-phenylpropanoyl] 2-hydroxy-3-(2-methylpropyl)benzoate is sourced from PubChem (CID 91259575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).