C25H35N3O4 — CID 91260234
tert-butyl 8-[N-ethenyl-C-[3-[(2-methyl-3-pyridinyl)oxy]but-2-en-2-yl]carbonimidoyl]oxy-5-azaspiro[2.5]octane-5-carboxylate (PubChem CID 91260234) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is tert-butyl 8-[N-ethenyl-C-[3-[(2-methyl-3-pyridinyl)oxy]but-2-en-2-yl]carbonimidoyl]oxy-5-azaspiro[2.5]octane-5-carboxylate.
| Compound Name | tert-butyl 8-[N-ethenyl-C-[3-[(2-methyl-3-pyridinyl)oxy]but-2-en-2-yl]carbonimidoyl]oxy-5-azaspiro[2.5]octane-5-carboxylate |
|---|---|
| PubChem CID | 91260234 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | tert-butyl 8-[N-ethenyl-C-[3-[(2-methyl-3-pyridinyl)oxy]but-2-en-2-yl]carbonimidoyl]oxy-5-azaspiro[2.5]octane-5-carboxylate |
| SMILES | C=C/N=C(/OC1CCN(C(=O)OC(C)(C)C)CC12CC2)C(C)=C(C)Oc1cccnc1C |
| InChI | InChI=1S/C25H35N3O4/c1-8-26-22(17(2)19(4)30-20-10-9-14-27-18(20)3)31-21-11-15-28(16-25(21)12-13-25)23(29)32-24(5,6)7/h8-10,14,21H,1,11-13,15-16H2,2-7H3/b19-17?,26-22+ |
| InChIKey | QDTPGBWHWMMYPQ-LPVQJNGKSA-N |
| XLogP | 5.41 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|