C14H13NO3S — CID 91261000
2-oxo-3-[5-(2-phenylethyl)-1,3-thiazol-2-yl]propanoic acid (PubChem CID 91261000) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-oxo-3-[5-(2-phenylethyl)-1,3-thiazol-2-yl]propanoic acid.
| Compound Name | 2-oxo-3-[5-(2-phenylethyl)-1,3-thiazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 91261000 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-oxo-3-[5-(2-phenylethyl)-1,3-thiazol-2-yl]propanoic acid |
| SMILES | O=C(O)C(=O)Cc1ncc(CCc2ccccc2)s1 |
| InChI | InChI=1S/C14H13NO3S/c16-12(14(17)18)8-13-15-9-11(19-13)7-6-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H,17,18) |
| InChIKey | SCNVLLUVOYRVAT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|