C22H25N6O2+ — CID 91261569
(7-amino-4-ethyl-5-morpholin-4-yl-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-4-ium-6-yl)methanol (PubChem CID 91261569) has the molecular formula C22H25N6O2+ and a molecular weight of 405.48 g/mol. Its IUPAC name is (7-amino-4-ethyl-5-morpholin-4-yl-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-4-ium-6-yl)methanol.
| Compound Name | (7-amino-4-ethyl-5-morpholin-4-yl-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-4-ium-6-yl)methanol |
|---|---|
| PubChem CID | 91261569 |
| Molecular Formula | C22H25N6O2+ |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | (7-amino-4-ethyl-5-morpholin-4-yl-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-4-ium-6-yl)methanol |
| SMILES | CC[n+]1c(N2CCOCC2)c(CO)c(N)n2ncc(-c3cnc4ccccc4c3)c21 |
| InChI | InChI=1S/C22H24N6O2/c1-2-27-21(26-7-9-30-10-8-26)18(14-29)20(23)28-22(27)17(13-25-28)16-11-15-5-3-4-6-19(15)24-12-16/h3-6,11-13,23,29H,2,7-10,14H2,1H3/p+1 |
| InChIKey | QVTXNTWOZPMIJP-UHFFFAOYSA-O |
| XLogP | 1.77 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|