C17H16FNO — CID 91261845
5-benzyl-3-(2-fluorophenyl)-5-methyl-2H-1,2-oxazole (PubChem CID 91261845) has the molecular formula C17H16FNO and a molecular weight of 269.32 g/mol. Its IUPAC name is 5-benzyl-3-(2-fluorophenyl)-5-methyl-2H-1,2-oxazole.
| Compound Name | 5-benzyl-3-(2-fluorophenyl)-5-methyl-2H-1,2-oxazole |
|---|---|
| PubChem CID | 91261845 |
| Molecular Formula | C17H16FNO |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 5-benzyl-3-(2-fluorophenyl)-5-methyl-2H-1,2-oxazole |
| SMILES | CC1(Cc2ccccc2)C=C(c2ccccc2F)NO1 |
| InChI | InChI=1S/C17H16FNO/c1-17(11-13-7-3-2-4-8-13)12-16(19-20-17)14-9-5-6-10-15(14)18/h2-10,12,19H,11H2,1H3 |
| InChIKey | NFKPTLRSSFWAIH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |