C19H10F19NO — CID 90941741
5-[2,2,3,3,4,4,5,5,6,6,7,7,8,9,9,9-hexadecafluoro-8-(trifluoromethyl)nonyl]-3-phenyl-2,5-dihydro-1,2-oxazole (PubChem CID 90941741) has the molecular formula C19H10F19NO and a molecular weight of 629.26 g/mol. Its IUPAC name is 5-[2,2,3,3,4,4,5,5,6,6,7,7,8,9,9,9-hexadecafluoro-8-(trifluoromethyl)nonyl]-3-phenyl-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-[2,2,3,3,4,4,5,5,6,6,7,7,8,9,9,9-hexadecafluoro-8-(trifluoromethyl)nonyl]-3-phenyl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 90941741 |
| Molecular Formula | C19H10F19NO |
| Molecular Weight | 629.26 g/mol |
| Exact Mass | 629.05 |
| IUPAC Name | 5-[2,2,3,3,4,4,5,5,6,6,7,7,8,9,9,9-hexadecafluoro-8-(trifluoromethyl)nonyl]-3-phenyl-2,5-dihydro-1,2-oxazole |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C19H10F19NO/c20-11(21,7-9-6-10(39-40-9)8-4-2-1-3-5-8)13(23,24)15(27,28)17(31,32)16(29,30)14(25,26)12(22,18(33,34)35)19(36,37)38/h1-6,9,39H,7H2 |
| InChIKey | QSZMLYDHGLQJOK-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.26 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|