C18H10F17NO — CID 91040505
5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)-3-phenyl-2,5-dihydro-1,2-oxazole (PubChem CID 91040505) has the molecular formula C18H10F17NO and a molecular weight of 579.25 g/mol. Its IUPAC name is 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)-3-phenyl-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)-3-phenyl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 91040505 |
| Molecular Formula | C18H10F17NO |
| Molecular Weight | 579.25 g/mol |
| Exact Mass | 579.05 |
| IUPAC Name | 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)-3-phenyl-2,5-dihydro-1,2-oxazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C18H10F17NO/c19-11(20,7-9-6-10(36-37-9)8-4-2-1-3-5-8)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)35/h1-6,9,36H,7H2 |
| InChIKey | XIZCSPQHMHNTSR-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.25 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|