C23H29NO5 — CID 91263655
(4R,9S,11S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-6,9,13-trimethyl-5-oxa-7-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,14,18-trien-16-one (PubChem CID 91263655) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is (4R,9S,11S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-6,9,13-trimethyl-5-oxa-7-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,14,18-trien-16-one.
| Compound Name | (4R,9S,11S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-6,9,13-trimethyl-5-oxa-7-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,14,18-trien-16-one |
|---|---|
| PubChem CID | 91263655 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (4R,9S,11S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-6,9,13-trimethyl-5-oxa-7-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,14,18-trien-16-one |
| SMILES | CC1=NC2(C(=O)CO)[C@@H](CC3C4CC=C5CC(=O)C=C[C@]5(C)C4C(O)C[C@@]32C)O1 |
| InChI | InChI=1S/C23H29NO5/c1-12-24-23(18(28)11-25)19(29-12)9-16-15-5-4-13-8-14(26)6-7-21(13,2)20(15)17(27)10-22(16,23)3/h4,6-7,15-17,19-20,25,27H,5,8-11H2,1-3H3/t15?,16?,17?,19-,20?,21+,22+,23?/m1/s1 |
| InChIKey | LZTLDIQPTJTRRE-VEYIAHJZSA-N |
| XLogP | 1.99 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|