C26H33N3O5 — CID 123255628
(1S,2S,4S,8R,9S,11S,12S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-6-(1H-imidazol-5-ylmethyl)-9,13-dimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-16-one (PubChem CID 123255628) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is (1S,2S,4S,8R,9S,11S,12S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-6-(1H-imidazol-5-ylmethyl)-9,13-dimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-16-one.
| Compound Name | (1S,2S,4S,8R,9S,11S,12S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-6-(1H-imidazol-5-ylmethyl)-9,13-dimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-16-one |
|---|---|
| PubChem CID | 123255628 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | (1S,2S,4S,8R,9S,11S,12S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-6-(1H-imidazol-5-ylmethyl)-9,13-dimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-16-one |
| SMILES | C[C@]12C=CC(=O)CC1=CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1C[C@H]1CN(Cc3cnc[nH]3)O[C@]12C(=O)CO |
| InChI | InChI=1S/C26H33N3O5/c1-24-6-5-18(31)7-15(24)3-4-19-20-8-16-11-29(12-17-10-27-14-28-17)34-26(16,22(33)13-30)25(20,2)9-21(32)23(19)24/h3,5-6,10,14,16,19-21,23,30,32H,4,7-9,11-13H2,1-2H3,(H,27,28)/t16-,19-,20-,21-,23+,24-,25-,26-/m0/s1 |
| InChIKey | SMYUNXXCXHAQGT-LCNFUIODSA-N |
| XLogP | 1.96 |
| TPSA | 115.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|