C27H31NO6S — CID 123413173
(1S,2S,4S,8R,9S,11S,12S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-(thiophene-3-carbonyl)-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-16-one (PubChem CID 123413173) has the molecular formula C27H31NO6S and a molecular weight of 497.61 g/mol. Its IUPAC name is (1S,2S,4S,8R,9S,11S,12S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-(thiophene-3-carbonyl)-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-16-one.
| Compound Name | (1S,2S,4S,8R,9S,11S,12S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-(thiophene-3-carbonyl)-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-16-one |
|---|---|
| PubChem CID | 123413173 |
| Molecular Formula | C27H31NO6S |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | (1S,2S,4S,8R,9S,11S,12S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-(thiophene-3-carbonyl)-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-16-one |
| SMILES | C[C@]12C=CC(=O)CC1=CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1C[C@H]1CN(C(=O)c3ccsc3)O[C@]12C(=O)CO |
| InChI | InChI=1S/C27H31NO6S/c1-25-7-5-18(30)9-16(25)3-4-19-20-10-17-12-28(24(33)15-6-8-35-14-15)34-27(17,22(32)13-29)26(20,2)11-21(31)23(19)25/h3,5-8,14,17,19-21,23,29,31H,4,9-13H2,1-2H3/t17-,19-,20-,21-,23+,25-,26-,27-/m0/s1 |
| InChIKey | LSEHKOFTKZPQTN-UGCNZUDWSA-N |
| XLogP | 2.94 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|