C28H35NO8S — CID 123674391
[2-[(1S,2S,4S,8R,9S,11S,12S,13R)-6-(furan-3-ylmethyl)-11-hydroxy-9,13-dimethyl-16-oxo-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-8-yl]-2-oxoethyl] methanesulfonate (PubChem CID 123674391) has the molecular formula C28H35NO8S and a molecular weight of 545.65 g/mol. Its IUPAC name is [2-[(1S,2S,4S,8R,9S,11S,12S,13R)-6-(furan-3-ylmethyl)-11-hydroxy-9,13-dimethyl-16-oxo-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-8-yl]-2-oxoethyl] methanesulfonate.
| Compound Name | [2-[(1S,2S,4S,8R,9S,11S,12S,13R)-6-(furan-3-ylmethyl)-11-hydroxy-9,13-dimethyl-16-oxo-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-8-yl]-2-oxoethyl] methanesulfonate |
|---|---|
| PubChem CID | 123674391 |
| Molecular Formula | C28H35NO8S |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | [2-[(1S,2S,4S,8R,9S,11S,12S,13R)-6-(furan-3-ylmethyl)-11-hydroxy-9,13-dimethyl-16-oxo-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-8-yl]-2-oxoethyl] methanesulfonate |
| SMILES | C[C@]12C=CC(=O)CC1=CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1C[C@H]1CN(Cc3ccoc3)O[C@]12C(=O)COS(C)(=O)=O |
| InChI | InChI=1S/C28H35NO8S/c1-26-8-6-20(30)10-18(26)4-5-21-22-11-19-14-29(13-17-7-9-35-15-17)37-28(19,24(32)16-36-38(3,33)34)27(22,2)12-23(31)25(21)26/h4,6-9,15,19,21-23,25,31H,5,10-14,16H2,1-3H3/t19-,21-,22-,23-,25+,26-,27-,28-/m0/s1 |
| InChIKey | YPXUTLOTJGQEBQ-IPBGIELMSA-N |
| XLogP | 2.82 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|