About 4-(cyclohexylamino)butyl sulfite
4-(cyclohexylamino)butyl sulfite (PubChem CID 91264096) has the molecular formula C10H20NO3S-
and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-(cyclohexylamino)butyl sulfite.
Molecular Properties
| Compound Name | 4-(cyclohexylamino)butyl sulfite |
| PubChem CID | 91264096 |
| Molecular Formula | C10H20NO3S- |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 4-(cyclohexylamino)butyl sulfite |
| SMILES | O=S([O-])OCCCCNC1CCCCC1 |
| InChI | InChI=1S/C10H21NO3S/c12-15(13)14-9-5-4-8-11-10-6-2-1-3-7-10/h10-11H,1-9H2,(H,12,13)/p-1 |
| InChIKey | YOVYXPAKZRNVHF-UHFFFAOYSA-M |
| XLogP | 1.50 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-(cyclohexylamino)butyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohexylamino)butyl sulfite?
The IUPAC name of 4-(cyclohexylamino)butyl sulfite (CID 91264096) is 4-(cyclohexylamino)butyl sulfite.
What is the SMILES notation for 4-(cyclohexylamino)butyl sulfite?
The canonical SMILES for 4-(cyclohexylamino)butyl sulfite is O=S([O-])OCCCCNC1CCCCC1.
What is the InChIKey of 4-(cyclohexylamino)butyl sulfite?
The InChIKey is YOVYXPAKZRNVHF-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H21NO3S/c12-15(13)14-9-5-4-8-11-10-6-2-1-3-7-10/h10-11H,1-9H2,(H,12,13)/p-1.
What are the key properties of 4-(cyclohexylamino)butyl sulfite?
4-(cyclohexylamino)butyl sulfite has a molecular weight of 234.34 g/mol, XLogP of 1.50, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohexylamino)butyl sulfite is sourced from PubChem (CID 91264096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).