C23H16N2O5S3 — CID 91264174
2-[3-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]thiophen-2-yl]sulfanylacetic acid (PubChem CID 91264174) has the molecular formula C23H16N2O5S3 and a molecular weight of 496.59 g/mol. Its IUPAC name is 2-[3-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]thiophen-2-yl]sulfanylacetic acid.
| Compound Name | 2-[3-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]thiophen-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 91264174 |
| Molecular Formula | C23H16N2O5S3 |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | 2-[3-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]thiophen-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1sccc1C=C1C(=O)NC(=S)N(c2ccc(Oc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C23H16N2O5S3/c26-19(27)13-33-22-14(10-11-32-22)12-18-20(28)24-23(31)25(21(18)29)15-6-8-17(9-7-15)30-16-4-2-1-3-5-16/h1-12H,13H2,(H,26,27)(H,24,28,31) |
| InChIKey | VCGOGSQMLLFMHD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|