C28H27ClIN3O5 — CID 91264182
(2S,3S)-N-(2-chloro-4-iodophenyl)-2-[4-hydroxy-5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1H-imidazol-3-yl]-3-phenylbutanamide (PubChem CID 91264182) has the molecular formula C28H27ClIN3O5 and a molecular weight of 647.90 g/mol. Its IUPAC name is (2S,3S)-N-(2-chloro-4-iodophenyl)-2-[4-hydroxy-5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1H-imidazol-3-yl]-3-phenylbutanamide.
| Compound Name | (2S,3S)-N-(2-chloro-4-iodophenyl)-2-[4-hydroxy-5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1H-imidazol-3-yl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 91264182 |
| Molecular Formula | C28H27ClIN3O5 |
| Molecular Weight | 647.90 g/mol |
| Exact Mass | 647.07 |
| IUPAC Name | (2S,3S)-N-(2-chloro-4-iodophenyl)-2-[4-hydroxy-5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1H-imidazol-3-yl]-3-phenylbutanamide |
| SMILES | COCCOc1ccc(-c2[nH]c(=O)n([C@H](C(=O)Nc3ccc(I)cc3Cl)[C@@H](C)c3ccccc3)c2O)cc1 |
| InChI | InChI=1S/C28H27ClIN3O5/c1-17(18-6-4-3-5-7-18)25(26(34)31-23-13-10-20(30)16-22(23)29)33-27(35)24(32-28(33)36)19-8-11-21(12-9-19)38-15-14-37-2/h3-13,16-17,25,35H,14-15H2,1-2H3,(H,31,34)(H,32,36)/t17-,25-/m0/s1 |
| InChIKey | RKZWYERTFHNDDO-GKVSMKOHSA-N |
| XLogP | 5.82 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.90 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|