C15H25NO6 — CID 91264746
methyl (2R,3S)-2-amino-3-hydroxybutanoate;trimethoxymethylbenzene (PubChem CID 91264746) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl (2R,3S)-2-amino-3-hydroxybutanoate;trimethoxymethylbenzene.
| Compound Name | methyl (2R,3S)-2-amino-3-hydroxybutanoate;trimethoxymethylbenzene |
|---|---|
| PubChem CID | 91264746 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | methyl (2R,3S)-2-amino-3-hydroxybutanoate;trimethoxymethylbenzene |
| SMILES | COC(=O)[C@H](N)[C@H](C)O.COC(OC)(OC)c1ccccc1 |
| InChI | InChI=1S/C10H14O3.C5H11NO3/c1-11-10(12-2,13-3)9-7-5-4-6-8-9;1-3(7)4(6)5(8)9-2/h4-8H,1-3H3;3-4,7H,6H2,1-2H3/t;3-,4+/m.0/s1 |
| InChIKey | RHODEKQAEIGLJI-RKNXPSPHSA-N |
| XLogP | 0.60 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|