C32H31N5O3S — CID 91271597
N-[2-oxo-3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-1,3-dihydroindol-5-yl]pyridine-2-sulfonamide (PubChem CID 91271597) has the molecular formula C32H31N5O3S and a molecular weight of 565.70 g/mol. Its IUPAC name is N-[2-oxo-3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-1,3-dihydroindol-5-yl]pyridine-2-sulfonamide.
| Compound Name | N-[2-oxo-3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-1,3-dihydroindol-5-yl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 91271597 |
| Molecular Formula | C32H31N5O3S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | N-[2-oxo-3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-1,3-dihydroindol-5-yl]pyridine-2-sulfonamide |
| SMILES | O=C1Nc2ccc(NS(=O)(=O)c3ccccn3)cc2C1/C(=N/c1ccc(CN2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H31N5O3S/c38-32-30(27-21-26(16-17-28(27)35-32)36-41(39,40)29-11-5-6-18-33-29)31(24-9-3-1-4-10-24)34-25-14-12-23(13-15-25)22-37-19-7-2-8-20-37/h1,3-6,9-18,21,30,36H,2,7-8,19-20,22H2,(H,35,38)/b34-31+ |
| InChIKey | YMXSELRBVNENKE-WUVHBKSUSA-N |
| XLogP | 5.72 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|