C28H27N5O3S — CID 123450750
N-(cyanomethyl)-2-oxo-3-[C-phenyl-N-[4-(pyrrolidin-1-ylmethyl)phenyl]carbonimidoyl]-1,3-dihydroindole-5-sulfonamide (PubChem CID 123450750) has the molecular formula C28H27N5O3S and a molecular weight of 513.62 g/mol. Its IUPAC name is N-(cyanomethyl)-2-oxo-3-[C-phenyl-N-[4-(pyrrolidin-1-ylmethyl)phenyl]carbonimidoyl]-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-(cyanomethyl)-2-oxo-3-[C-phenyl-N-[4-(pyrrolidin-1-ylmethyl)phenyl]carbonimidoyl]-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 123450750 |
| Molecular Formula | C28H27N5O3S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | N-(cyanomethyl)-2-oxo-3-[C-phenyl-N-[4-(pyrrolidin-1-ylmethyl)phenyl]carbonimidoyl]-1,3-dihydroindole-5-sulfonamide |
| SMILES | N#CCNS(=O)(=O)c1ccc2c(c1)C(/C(=N/c1ccc(CN3CCCC3)cc1)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C28H27N5O3S/c29-14-15-30-37(35,36)23-12-13-25-24(18-23)26(28(34)32-25)27(21-6-2-1-3-7-21)31-22-10-8-20(9-11-22)19-33-16-4-5-17-33/h1-3,6-13,18,26,30H,4-5,15-17,19H2,(H,32,34)/b31-27+ |
| InChIKey | NSELOIXUFGWSNI-TVKQRKNISA-N |
| XLogP | 3.94 |
| TPSA | 114.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|