C36H44N6O4S — CID 123655342
N-(oxan-4-yl)-2-oxo-3-[C-phenyl-N-[4-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]phenyl]carbonimidoyl]-1,3-dihydroindole-5-sulfonamide (PubChem CID 123655342) has the molecular formula C36H44N6O4S and a molecular weight of 656.85 g/mol. Its IUPAC name is N-(oxan-4-yl)-2-oxo-3-[C-phenyl-N-[4-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]phenyl]carbonimidoyl]-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-(oxan-4-yl)-2-oxo-3-[C-phenyl-N-[4-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]phenyl]carbonimidoyl]-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 123655342 |
| Molecular Formula | C36H44N6O4S |
| Molecular Weight | 656.85 g/mol |
| Exact Mass | 656.31 |
| IUPAC Name | N-(oxan-4-yl)-2-oxo-3-[C-phenyl-N-[4-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]phenyl]carbonimidoyl]-1,3-dihydroindole-5-sulfonamide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)NC3CCOCC3)cc2C1/C(=N/c1ccc(N2CCN(CCN3CCCC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C36H44N6O4S/c43-36-34(32-26-31(12-13-33(32)38-36)47(44,45)39-29-14-24-46-25-15-29)35(27-6-2-1-3-7-27)37-28-8-10-30(11-9-28)42-22-20-41(21-23-42)19-18-40-16-4-5-17-40/h1-3,6-13,26,29,34,39H,4-5,14-25H2,(H,38,43)/b37-35+ |
| InChIKey | DYAXPXJONQEXEJ-MHAUTQJVSA-N |
| XLogP | 4.22 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|